Mucic acid structure
|
Common Name | Mucic acid | ||
|---|---|---|---|---|
| CAS Number | 526-99-8 | Molecular Weight | 210.139 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 766.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C6H10O8 | Melting Point | 220-225 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 431.2±29.4 °C | |
| Name | galactaric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 766.4±60.0 °C at 760 mmHg |
| Melting Point | 220-225 °C (dec.)(lit.) |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.139 |
| Flash Point | 431.2±29.4 °C |
| Exact Mass | 210.037567 |
| PSA | 155.52000 |
| LogP | -1.46 |
| Vapour Pressure | 0.0±5.9 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | DSLZVSRJTYRBFB-DUHBMQHGSA-N |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)C(=O)O |
| Storage condition | Store at RT. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi,Xn |
| Risk Phrases | 22-40 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | LW5180000 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
|
Coformer screening using thermal analysis based on binary phase diagrams.
Pharm. Res. 31(8) , 1946-57, (2014) The advent of cocrystals has demonstrated a growing need for efficient and comprehensive coformer screening in search of better development forms, including salt forms. Here, we investigated a coforme... |
|
|
Synthesis and characterization of copolyanhydrides of carbohydrate-based galactaric acid and adipic acid.
Carbohydr. Res. 402 , 102-10, (2014) A series of copolyanhydrides, consisting of 2,3,4,5-tetra-O-acetylgalactaric acid (AGA) and adipic acid (AA) as monomer units, was polymerized. Synthesis of AGA monomer consisted of two steps. First, ... |
|
|
Okibacterium endophyticum sp. nov., a novel endophytic actinobacterium isolated from roots of Salsola affinis C. A. Mey.
Antonie van Leeuwenhoek 107(3) , 835-43, (2015) A white bacterial strain, designated EGI 650022(T), was isolated from the roots of Salsola affinis C. A. Mey, collected from Urumqi City, Xinjiang, north-western China. The strain was found to be aero... |
| GALATARIC ACID |
| (2R,3S,4R,5S)-2,3,4,5-Tetrahydroxyhexanedioic acid |
| Schleimsaure |
| Galactarsaeure |
| Mucic |
| Galactaric acid |
| Mucicacid |
| Mucic acid |
| meso-galactaric acid |
| D-Galactaric acid |
| Galactosaccharic acid |
| Mucate |
| 2,3,4,5-Tetrahydroxyadipic Acid |
| D-Mucic acid |
| GALACTERIC ACID |
| L-Mucic acid |
| MFCD00004239 |
| EINECS 208-404-0 |
| Galactaric acid, D- |