WAY-606816
Modify Date: 2024-04-05 23:51:23
WAY-606816 structure
|
Common Name | WAY-606816 | ||
|---|---|---|---|---|
| CAS Number | 521318-69-4 | Molecular Weight | 426.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-606816extracellular IDE inhibitor; inhibitor of PHOSPHO1; bacterial PyrG (CTP synthase) inhibitor; modulating RNA-binding proteins; |
| Name | WAY-606816 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14N2O5S2 |
|---|---|
| Molecular Weight | 426.47 |
| InChIKey | FEVKOYDOEFRIDM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cccc(-n2sc3ccccc3c2=O)c1 |
| Benzoic acid, 2-[[[3-(3-oxo-1,2-benzisothiazol-2(3H)-yl)phenyl]sulfonyl]amino]- |