Mal-PEG4-Boc structure
|
Common Name | Mal-PEG4-Boc | ||
|---|---|---|---|---|
| CAS Number | 518044-36-5 | Molecular Weight | 401.451 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 499.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C19H31NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.1±27.3 °C | |
Use of Mal-PEG4-BocMal-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12-tetraoxapentadecan-15-oate |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.9±40.0 °C at 760 mmHg |
| Molecular Formula | C19H31NO8 |
| Molecular Weight | 401.451 |
| Flash Point | 256.1±27.3 °C |
| Exact Mass | 401.204956 |
| LogP | 0.25 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | IYFQIVYGXSVHRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12-tetraoxapentadecan-15-oate |
| 3,6,9,12-Tetraoxapentadecan-15-oic acid, 1-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 1,1-dimethylethyl ester |
| MFCD22683300 |