Malonylgenistin structure
|
Common Name | Malonylgenistin | ||
|---|---|---|---|---|
| CAS Number | 51011-05-3 | Molecular Weight | 518.424 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 880.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C24H22O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.0±27.8 °C | |
Use of Malonylgenistin6''-O-Malonylgenistin(Malonylgenistin) is an isoflavone derivative. |
| Name | 6''-o-malonylgenistin |
|---|---|
| Synonym | More Synonyms |
| Description | 6''-O-Malonylgenistin(Malonylgenistin) is an isoflavone derivative. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 880.2±65.0 °C at 760 mmHg |
| Molecular Formula | C24H22O13 |
| Molecular Weight | 518.424 |
| Flash Point | 302.0±27.8 °C |
| Exact Mass | 518.106018 |
| PSA | 213.42000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | FRAUJUKWSKMNJY-RSEYPYQYSA-N |
| SMILES | O=C(O)CC(=O)OCC1OC(Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c2)C(O)C(O)C1O |
| Storage condition | Store at -20 |
| Precursor 0 | |
|---|---|
| DownStream 4 | |
| malonyl genistin |
| 6-O-Malonylgenistin,free acid |
| 5-Hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| genistein 7-O-glucosyl 6''-O-malonate |
| Malonylgenistin |
| Genistin malonate |
| β-D-Glucopyranoside, 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl, 6-(2-carboxyacetate) |
| 7-O-Glucosyl-6'-Malonyl Genistein |
| Genistin 6''-O-Malonate |