Mitraphylline
Modify Date: 2025-08-25 09:40:53
Mitraphylline structure
|
Common Name | Mitraphylline | ||
|---|---|---|---|---|
| CAS Number | 509-80-8 | Molecular Weight | 368.42600 | |
| Density | 1.33 g/cm3 | Boiling Point | 555.2ºC | |
| Molecular Formula | C21H24N2O4 | Melting Point | 258-267 °C | |
| MSDS | N/A | Flash Point | 289.6ºC | |
Use of MitraphyllineMitraphylline is the major pentacyclic oxindolic alkaloid presented in Uncaria tomentosa. Mitraphylline inhibits lipopolysaccharide-mediated activation of primary human neutrophils[1]. |
| Name | methyl (1S,4aS,5aS,6R,10aR)-1-methyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Mitraphylline is the major pentacyclic oxindolic alkaloid presented in Uncaria tomentosa. Mitraphylline inhibits lipopolysaccharide-mediated activation of primary human neutrophils[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33 g/cm3 |
|---|---|
| Boiling Point | 555.2ºC |
| Melting Point | 258-267 °C |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.42600 |
| Flash Point | 289.6ºC |
| Exact Mass | 368.17400 |
| PSA | 67.87000 |
| LogP | 2.13840 |
| Index of Refraction | 1.635 |
| InChIKey | JMIAZDVHNCCPDM-DAFCLMLCSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)Nc5ccccc54)C3CC12 |
| ajmalicine oxindole-B |
| HMS2267P09 |
| Mitraphilline |
| EINECS 208-106-0 |
| rubradinine |
| Mitraphylline |
| Mitraphyllin |