WAY-324128
Modify Date: 2025-10-29 17:01:11
WAY-324128 structure
|
Common Name | WAY-324128 | ||
|---|---|---|---|---|
| CAS Number | 500263-71-8 | Molecular Weight | 408.4 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 576.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5±30.1 °C | |
Use of WAY-324128PDE4D inhibitor |
| Name | WAY-324128 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 576.6±50.0 °C at 760 mmHg |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.4 |
| Flash Point | 302.5±30.1 °C |
| Exact Mass | 408.132141 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | LYBNBVMYGZUJMM-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(-c3ccc4c(c3)C(=O)N(CC(C)C)C4=O)oc(=O)c2cc1OC |
| 5-(6,7-Dimethoxy-4-oxo-4H-3,1-benzoxazin-2-yl)-2-isobutyl-1H-isoindole-1,3(2H)-dione |
| 1H-Isoindole-1,3(2H)-dione, 5-(6,7-dimethoxy-4-oxo-4H-3,1-benzoxazin-2-yl)-2-(2-methylpropyl)- |