Di-2-pyridylglyoxal structure
|
Common Name | Di-2-pyridylglyoxal | ||
|---|---|---|---|---|
| CAS Number | 492-73-9 | Molecular Weight | 212.20400 | |
| Density | 1.271 g/cm3 | Boiling Point | 400ºC at 760 mmHg | |
| Molecular Formula | C12H8N2O2 | Melting Point | 154-156 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 198.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,2-dipyridin-2-ylethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271 g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760 mmHg |
| Melting Point | 154-156 °C(lit.) |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.20400 |
| Flash Point | 198.2ºC |
| Exact Mass | 212.05900 |
| PSA | 59.92000 |
| LogP | 1.54220 |
| Vapour Pressure | 1.31E-06mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | PIINXYKJQGMIOZ-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccccn1)c1ccccn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| Di-2-pyridylglyoxal |
| EINECS 207-759-9 |
| Ethanedione,di-2-pyridinyl |
| 1,2-bis(pyridin-2-yl)ethane-1,2-dione |
| Bipicolinoyl |
| 2,2'-Pyridil |
| 1,2-bis-(2-pyridyl)-ethane-1,2-dione |
| Glyoxal,di-2-pyridyl |
| 1,2-di(2-pyridyl)ethane-1,2-dione |
| 1,2-di(pyridin-2-yl)-ethane-1,2-dione |
| 2,2'-ETHYLENEDIANILINE |
| MFCD00006301 |