See also 1,2-Ethenediol,1,2-di-2-pyridinyl- structure
|
Common Name | See also 1,2-Ethenediol,1,2-di-2-pyridinyl- | ||
|---|---|---|---|---|
| CAS Number | 3891-65-4 | Molecular Weight | 214.22000 | |
| Density | 1.301g/cm3 | Boiling Point | 361.7ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | (2Z)-2-hydroxy-1-pyridin-2-yl-2-(1H-pyridin-2-ylidene)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 361.7ºC at 760 mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 172.5ºC |
| Exact Mass | 214.07400 |
| PSA | 66.24000 |
| LogP | 2.41840 |
| Index of Refraction | 1.636 |
| InChIKey | CQKOWIAZMZUHNW-UHFFFAOYSA-N |
| SMILES | OC(=C(O)c1ccccn1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2'-pyridoin |