TB-03
Modify Date: 2025-08-25 19:17:20
TB-03 structure
|
Common Name | TB-03 | ||
|---|---|---|---|---|
| CAS Number | 491831-49-3 | Molecular Weight | 708.73800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H45N4O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TB-03A small molecule Grb2 SH2 domain binding antagonist that synergistically enhances inhibition of K562 leukemia cell proliferation by imatinib (CI=0.774). |
| Name | (3R)-4-[[1-[[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]carbamoyl]cyclohexyl]amino]-4-oxo-3-[[4-(phosphonomethyl)phenyl]methyl]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C36H45N4O9P |
|---|---|
| Molecular Weight | 708.73800 |
| Exact Mass | 708.29200 |
| PSA | 235.03000 |
| LogP | 4.95220 |
| InChIKey | AYRBFDFQLSQIBI-DGPALRBDSA-N |
| SMILES | NC(=O)CC(NC(=O)C1(NC(=O)C(CC(=O)O)Cc2ccc(CP(=O)(O)O)cc2)CCCCC1)C(=O)NCCCc1cccc2ccccc12 |
| TB-03 |