WAY-351285
Modify Date: 2024-04-06 07:39:46
WAY-351285 structure
|
Common Name | WAY-351285 | ||
|---|---|---|---|---|
| CAS Number | 450336-72-8 | Molecular Weight | 395.34 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 617.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H16F3N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.1±31.5 °C | |
Use of WAY-351285modulators of TRPA1 |
| Name | WAY-351285 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 617.2±55.0 °C at 760 mmHg |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 |
| Flash Point | 327.1±31.5 °C |
| Exact Mass | 351.105286 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | YGUVIHHRSRVKBT-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2 |
| N-[2-(4-Fluorophenyl)-5,5-dioxido-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]-3-methylbutanamide |
| Butanamide, N-[2-(4-fluorophenyl)-2,6-dihydro-5,5-dioxido-4H-thieno[3,4-c]pyrazol-3-yl]-3-methyl- |