ITK inhibitor structure
|
Common Name | ITK inhibitor | ||
|---|---|---|---|---|
| CAS Number | 439574-61-5 | Molecular Weight | 609.802 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H39N5O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ITK inhibitorITK inhibitor is a potent ITK inhibitor. |
| Name | N-[5-[5-(4-acetylpiperazine-1-carbonyl)-4-methoxy-2-methylphenyl]sulfanyl-1,3-thiazol-2-yl]-4-[(3-methylbutan-2-ylamino)methyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | ITK inhibitor is a potent ITK inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C31H39N5O4S2 |
| Molecular Weight | 609.802 |
| Exact Mass | 609.244324 |
| PSA | 157.41000 |
| LogP | 4.20 |
| Index of Refraction | 1.640 |
| InChIKey | RRHONYZEMUNMJX-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(Sc2cnc(NC(=O)c3ccc(CNC(C)C(C)C)cc3)s2)cc1C(=O)N1CCN(C(C)=O)CC1 |
| ITK inhibitor |
| HMS3265G21 |
| HMS3265G22 |
| HMS3265H21 |
| Benzamide, N-[5-[[5-[(4-acetyl-1-piperazinyl)carbonyl]-4-methoxy-2-methylphenyl]thio]-2-thiazolyl]-4-[[(1,2-dimethylpropyl)amino]methyl]- |
| HMS3265H22 |
| N-[5-({5-[(4-Acetyl-1-piperazinyl)carbonyl]-4-methoxy-2-methylphenyl}sulfanyl)-1,3-thiazol-2-yl]-4-{[(3-methyl-2-butanyl)amino]methyl}benzamide |