WAY-325454 structure
|
Common Name | WAY-325454 | ||
|---|---|---|---|---|
| CAS Number | 438474-60-3 | Molecular Weight | 341.79 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 495.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2±28.7 °C | |
Use of WAY-32545411β-hydroxysteroid dehydrogenase type 1 modulator |
| Name | WAY-325454 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.0±45.0 °C at 760 mmHg |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 |
| Flash Point | 253.2±28.7 °C |
| Exact Mass | 341.081879 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | AUSQFGIOJWIZPY-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1ccc(COc2ccccc2Cl)o1)c1ccccc1 |
| 5-[(2-Chlorophenoxy)methyl]-N-methyl-N-phenyl-2-furamide |
| 2-Furancarboxamide, 5-[(2-chlorophenoxy)methyl]-N-methyl-N-phenyl- |