ReAsH-EDT2
Modify Date: 2025-08-25 10:31:24
ReAsH-EDT2 structure
|
Common Name | ReAsH-EDT2 | ||
|---|---|---|---|---|
| CAS Number | 438226-89-2 | Molecular Weight | 545.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13As2NO3S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ReAsH-EDT2ReAsH-EDT2 is a red fluorescent dye that marks proteins. ReAsH-EDT2 is a membrane-permeable biarsenical compound that binds covalently to tetracysteine sequences which allows the protein to be imaged. ReAsH-EDT2 can be used for protein localization and trafficking. (λex=530 nm, λem=592 nm)[1][2]. |
| Name | 4,6-bis(1,3,2-dithiarsolan-2-yl)-7-hydroxyphenoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | ReAsH-EDT2 is a red fluorescent dye that marks proteins. ReAsH-EDT2 is a membrane-permeable biarsenical compound that binds covalently to tetracysteine sequences which allows the protein to be imaged. ReAsH-EDT2 can be used for protein localization and trafficking. (λex=530 nm, λem=592 nm)[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | ReAsH-EDT2 tags with GyrB.FGFR1KD.TC can appear with red fluorescence. |
| References |
| Molecular Formula | C16H13As2NO3S4 |
|---|---|
| Molecular Weight | 545.38300 |
| Exact Mass | 544.82100 |
| PSA | 164.53000 |
| LogP | 2.34880 |
| InChIKey | UNIBJWQHKWCMGJ-UHFFFAOYSA-N |
| SMILES | O=c1ccc2nc3ccc(O)c([As]4SCCS4)c3oc-2c1[As]1SCCS1 |
| Lumio Red |
| ReAsH-EDT2 |
| 3H-Phenoxazin-3-one,4,6-di-1,3,2-dithiarsolan-2-yl-7-hydroxy |
| 4,6-Di-1,3,2-dithiarsolan-2-yl-7-hydroxy-3H-phenoxazin-3-one |