WAY-347350
Modify Date: 2024-04-06 12:23:58
WAY-347350 structure
|
Common Name | WAY-347350 | ||
|---|---|---|---|---|
| CAS Number | 429650-71-5 | Molecular Weight | 340.44 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 650.7±61.0 °C at 760 mmHg | |
| Molecular Formula | C19H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.3±33.2 °C | |
Use of WAY-347350antagonists of vasoactive intestinal peptide receptor-1 (VIPR1) |
| Name | WAY-347350 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 650.7±61.0 °C at 760 mmHg |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.44 |
| Flash Point | 347.3±33.2 °C |
| Exact Mass | 334.088837 |
| LogP | 4.62 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.751 |
| InChIKey | RIUBSTOYHQDYQL-UHFFFAOYSA-N |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2)n1)c1c[nH]c2ccccc12 |
| ethanone, 1-(1H-indol-3-yl)-2-[(5-phenyl-4H-1,2,4-triazol-3-yl)thio]- |
| 1-(1H-Indol-3-yl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| Ethanone, 1-(1H-indol-3-yl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)thio]- |