WAY-311499 structure
|
Common Name | WAY-311499 | ||
|---|---|---|---|---|
| CAS Number | 421584-03-4 | Molecular Weight | 330.77 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 499.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.1±31.5 °C | |
Use of WAY-311499altering the lifespan of a eukaryotic organism |
| Name | WAY-311499 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.9±55.0 °C at 760 mmHg |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 |
| Flash Point | 256.1±31.5 °C |
| Exact Mass | 330.077118 |
| LogP | 5.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | KZBRCQVQYZVOAM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2noc(COc3ccc(Cl)c(C)c3)n2)cc1 |
| 1,2,4-Oxadiazole, 5-[(4-chloro-3-methylphenoxy)methyl]-3-(4-methoxyphenyl)- |
| 5-[(4-Chloro-3-methylphenoxy)methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| 5-(4-Chloro-3-methyl-phenoxymethyl)-3-(4-methoxy-phenyl)-[1,2,4]oxadiazole |