Profenofos structure
|
Common Name | Profenofos | ||
|---|---|---|---|---|
| CAS Number | 41198-08-7 | Molecular Weight | 373.631 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 401.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H15BrClO3PS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 196.8±31.5 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of ProfenofosProfenofos is an acetylcholinesterase-inhibiting organophosphorus pesticide on field crops, vegetables, and fruit crops [1]. |
| Name | profenofos |
|---|---|
| Synonym | More Synonyms |
| Description | Profenofos is an acetylcholinesterase-inhibiting organophosphorus pesticide on field crops, vegetables, and fruit crops [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.8±55.0 °C at 760 mmHg |
| Molecular Formula | C11H15BrClO3PS |
| Molecular Weight | 373.631 |
| Flash Point | 196.8±31.5 °C |
| Exact Mass | 371.935120 |
| PSA | 70.64000 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.553 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H317-H410 |
| Precautionary Statements | P261-P273-P280-P302 + P352 + P312-P304 + P340 + P312-P333 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N,T |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37-S60-S61-S45-S9-S7 |
| RIDADR | 3018 |
| RTECS | TE6975000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2930909062 |
| HS Code | 2930909062 |
|---|---|
| Summary | 2930909062 s-((tert-butylthio)methyl) o,o-diethyl phosphorodithioate |
|
Poisoning with the S-Alkyl organophosphorus insecticides profenofos and prothiofos.
QJM 102(11) , 785-92, (2009) Many organophosphorus (OP) insecticides have either two O-methyl or two O-ethyl groups attached to the phosphorus atom. This chemical structure affects their responsiveness to oxime-induced acetylchol... |
|
|
Development of a new extraction method based on counter current salting-out homogenous liquid-liquid extraction followed by dispersive liquid-liquid microextraction: Application for the extraction and preconcentration of widely used pesticides from fruit juices.
Talanta 146 , 772-9, (2015) In this paper, a new extraction method based on counter current salting-out homogenous liquid-liquid extraction (CCSHLLE) followed by dispersive liquid-liquid microextraction (DLLME) has been develope... |
|
|
The role of methanol addition to water samples in reducing analyte adsorption and matrix effects in liquid chromatography-tandem mass spectrometry.
J. Chromatogr. A. 1389 , 76-84, (2015) Liquid chromatography-tandem mass spectrometry (LC-MS/MS) analysis coupled simply with water filtering before injection has proven to be a simple, economic and time-saving method for analyzing trace-l... |
| TaMbo |
| Profenophos |
| Calofos |
| (RS)-(O-4-bromo-2-chlorophenyl O-ethyl S-propyl phosphorothioate) |
| (Ξ)-[O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate] |
| EINECS 255-255-2 |
| MFCD00078736 |
| Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester (9CI) |
| O-ethyl S-n-propyl O-4-bromo-2-chlorophenyl phosphorothiolate |
| UNII:7J04O7BS4W |
| O-4-bromo-2-chlorophenyl O-ethyl S-propyl phosphorothioate |
| Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| Prowess |
| Selecron |
| POLYCRON |
| O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
| Profenofos |
| SANOFOS |
| ROMIFOS |
| FORNOFOS |
| PRAHAR |