WAY-622134
Modify Date: 2025-11-30 20:30:34
WAY-622134 structure
|
Common Name | WAY-622134 | ||
|---|---|---|---|---|
| CAS Number | 409356-56-5 | Molecular Weight | 448.58 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 664.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C26H28N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.7±34.3 °C | |
Use of WAY-62213411β-HSD1 inhibitor |
| Name | WAY-622134 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 664.5±65.0 °C at 760 mmHg |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.58 |
| Flash Point | 355.7±34.3 °C |
| Exact Mass | 448.182068 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | PEOPQRYUIQSKSG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)N3CCc4ccccc4C3)cc2)S(C)(=O)=O)cc1C |
| Methanesulfonamide, N-[[4-[(3,4-dihydro-2(1H)-isoquinolinyl)carbonyl]phenyl]methyl]-N-(3,4-dimethylphenyl)- |
| N-[4-(3,4-Dihydro-2(1H)-isoquinolinylcarbonyl)benzyl]-N-(3,4-dimethylphenyl)methanesulfonamide |