Syringetin 3-O-glucoside
Modify Date: 2025-08-25 00:36:58
Syringetin 3-O-glucoside structure
|
Common Name | Syringetin 3-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 40039-49-4 | Molecular Weight | 508.42900 | |
| Density | 1.73g/cm3 | Boiling Point | 850.6ºC at 760 mmHg | |
| Molecular Formula | C23H24O13 | Melting Point | 250ºC (dec.) | |
| MSDS | N/A | Flash Point | 292.9ºC | |
Use of Syringetin 3-O-glucosideSyringetin-3-O-glucosid (Syringetin 3-O-β-D-glucoside), a flavonol glycoside, shows relatively weak DPPH and ABTS radical scavenging activity[1]. |
| Name | syringetin-3-glucoside |
|---|---|
| Synonym | More Synonyms |
| Description | Syringetin-3-O-glucosid (Syringetin 3-O-β-D-glucoside), a flavonol glycoside, shows relatively weak DPPH and ABTS radical scavenging activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 850.6ºC at 760 mmHg |
| Melting Point | 250ºC (dec.) |
| Molecular Formula | C23H24O13 |
| Molecular Weight | 508.42900 |
| Flash Point | 292.9ºC |
| Exact Mass | 508.12200 |
| PSA | 208.74000 |
| Index of Refraction | 1.729 |
| InChIKey | JMFWYRWPJVEZPV-BZMFKJDCSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC2OC(CO)C(O)C(O)C2O)cc(OC)c1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:10257-28-0
CAS#:4423-37-4| SYRINGETIN-3-O-GLUCOSIDE |
| syringetin 3-galactoside |
| syringetin 3-O-galactoside |
| Syringetin 3-O-glucoside |