1-Fluoro-4-nitro-2-(trifluoromethyl)benzene structure
|
Common Name | 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 400-74-8 | Molecular Weight | 209.098 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 214.7±0.0 °C at 760 mmHg | |
| Molecular Formula | C7H3F4NO2 | Melting Point | 22-24°C | |
| MSDS | Chinese USA | Flash Point | 91.7±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Fluoro-5-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 214.7±0.0 °C at 760 mmHg |
| Melting Point | 22-24°C |
| Molecular Formula | C7H3F4NO2 |
| Molecular Weight | 209.098 |
| Flash Point | 91.7±0.0 °C |
| Exact Mass | 209.009995 |
| PSA | 45.82000 |
| LogP | 2.49 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | DNTHMWUMRGOJRY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)c(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S23 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
|
~%
1-Fluoro-4-nitr... CAS#:400-74-8 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 6034,6037 |
|
~%
1-Fluoro-4-nitr... CAS#:400-74-8 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 6034,6037 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Electron-capturing derivatization of neutral steroids for increasing sensitivity in liquid chromatography/negative atmospheric pressure chemical ionization-mass spectrometry.
Anal. Sci. 18(12) , 1301-7, (2002) Derivatization of neutral steroids for increasing sensitivity in liquid chromatography/negative atmospheric pressure chemical ionization-mass spectrometry (APCI-MS) has been examined. Under APCI condi... |
|
|
Isomerisation accompanying fluorodenitration of trifluoromethyl activated diphenyl sulfones. Clark JH and Wails D.
Tetrahedron Lett. 34(24) , 3901-2, (1993)
|
| WNR DF CXFFF |
| 2-Fluoro-5-nitrobenzotrifluoride |
| 1-fluoro-2-(trifluoromethyl)-4-nitrobenzene |
| 2-fluoro-5-nitrotrifluorotoluol |
| 2-Fluor-5-Nitrobenzotrifluorid |
| α,α,α,2-Tetrafluoro-5-nitrotoluene |
| 2-FLUORO-5-NITRO TRIFLUORO METHYL |
| 5-Nitro-α,α,α,2-tetrafluorotoluene |
| 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene |
| 4-Flouro-3-trifluoromethyl-1-nitrobenzene |
| 4-nitro-2-(trifluoromethyl)fluorobenzene |
| 3-trifluoromethyl-4-fluoronitrobenzene |
| 1-fluoro-4-nitro-2-trifluoromethylbenzene |
| Benzene, 1-fluoro-4-nitro-2-(trifluoromethyl)- |
| EINECS 206-925-8 |
| 2-Fluoro-5-nitrobenz |
| 2-Fluoro-5-Nitrobenzotrifluori |
| MFCD00024576 |