1,1'-OXYBIS[4-NITRO-2-TRIFLUOROMETHYLBENZENE] structure
|
Common Name | 1,1'-OXYBIS[4-NITRO-2-TRIFLUOROMETHYLBENZENE] | ||
|---|---|---|---|---|
| CAS Number | 344-47-8 | Molecular Weight | 396.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6F6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-1-[4-nitro-2-(trifluoromethyl)phenoxy]-2-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6F6N2O5 |
|---|---|
| Molecular Weight | 396.19800 |
| Exact Mass | 396.01800 |
| PSA | 100.87000 |
| LogP | 6.37930 |
| InChIKey | TUQSSAYQECWEKB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc([N+](=O)[O-])cc2C(F)(F)F)c(C(F)(F)F)c1 |
| HS Code | 2904909090 |
|---|
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5122613 A1, 1992 ; |
|
~99%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5475149 A1, 1995 ; |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5475149 A1, 1995 ; |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5475149 A1, 1995 ; |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5475149 A1, 1995 ; |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Finger; Kruse Journal of the American Chemical Society, 1956 , vol. 78, p. 6034,6037 |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Occidental Chemical Corporation Patent: US5475149 A1, 1995 ; |
|
~%
1,1'-OXYBIS[4-N... CAS#:344-47-8 |
| Literature: Filler,R.; Novar,H. Journal of Organic Chemistry, 1961 , vol. 26, p. 2707 - 2710 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,1'-oxybis[4-nitro-2-(trifluoromethyl) |
| Bis-(4-nitro-2-trifluormethyl-phenyl)-aether |
| Ether,bis(a,a,a-trifluoro-4-nitro-o-tolyl) (6CI,8CI) |
| 4,4'-Dinitro-2,2'-bis-trifluormethyl-diphenylether |
| bis-(4-nitro-2-trifluoromethyl-phenyl)-ether |
| 2,2'-Bis-trifluormethyl-4,4'-dinitro-diphenylaether |
| 4,4'-oxy-bis[3-(trifluoromethyl)nitrobenzene] |
| 4,4'-Dinitro-2,2'-bis(trifluoromethyl)diphenyl ether |
| 4,4'-dinitro-2,2'-di(trifluoromethyl)diphenyl ether |