methyl 4-(4-methoxycarbonylphenyl)sulfonylbenzoate structure
|
Common Name | methyl 4-(4-methoxycarbonylphenyl)sulfonylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 3965-53-5 | Molecular Weight | 334.34400 | |
| Density | 1.318g/cm3 | Boiling Point | 505.4ºC at 760mmHg | |
| Molecular Formula | C16H14O6S | Melting Point | 195-196ºC(lit.) | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | methyl 4-(4-methoxycarbonylphenyl)sulfonylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 505.4ºC at 760mmHg |
| Melting Point | 195-196ºC(lit.) |
| Molecular Formula | C16H14O6S |
| Molecular Weight | 334.34400 |
| Flash Point | 259.5ºC |
| Exact Mass | 334.05100 |
| PSA | 95.12000 |
| LogP | 3.17340 |
| Index of Refraction | 1.564 |
| InChIKey | YQYRQRUZQNRJIW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(S(=O)(=O)c2ccc(C(=O)OC)cc2)cc1 |
| Safety Phrases | 24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~%
methyl 4-(4-met... CAS#:3965-53-5 |
| Literature: Murahashi; Anzai Kobunshi Kagaku, 1946 , vol. 3, p. 33,39 Chem.Abstr., 1950 , p. 11106 |
|
~%
methyl 4-(4-met... CAS#:3965-53-5 |
| Literature: Murahashi; Anzai Kobunshi Kagaku, 1946 , vol. 3, p. 33,39 Chem.Abstr., 1950 , p. 11106 |
|
~%
methyl 4-(4-met... CAS#:3965-53-5
Detail
|
| Literature: Brinon, M.C.; Bertorello, M.M. de; Bertorello, H.E.; Luna, L. Bulletin des Societes Chimiques Belges, 1987 , vol. 96, # 1 p. 41 - 50 |
|
~%
methyl 4-(4-met... CAS#:3965-53-5
Detail
|
| Literature: Brinon, M.C.; Bertorello, M.M. de; Bertorello, H.E.; Luna, L. Bulletin des Societes Chimiques Belges, 1987 , vol. 96, # 1 p. 41 - 50 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,4,4'-sulfonyldi-,dimethyl ester |
| Bis-(4-methoxycarbonyl-phenyl)-sulfon |
| 4,4'-dicarbomethoxydiphenyl sulfone |
| Benzoic acid,4,4'-sulfonylbis-,dimethyl ester |
| Dimethyl 4,4'-sulphonyldibenzoate |
| Diphenylsulfon-dicarbonsaeure-(4.4')-dimethylester |
| methyl 4-{[4-(methoxycarbonyl)phenyl]sulfonyl}benzoate |
| dimethyl 4,4'-sulfonylbis(benzoate) |
| MFCD00008439 |
| EINECS 223-577-2 |
| 4,4'-Sulfonyl-di-benzoesaeure-dimethylester |
| 4,4'-sulfonyl-di-benzoic acid dimethyl ester |
| Dimethyl 4,4'-sulfonyldibenzoate |