di-p-tolyl sulfone structure
|
Common Name | di-p-tolyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 599-66-6 | Molecular Weight | 246.32500 | |
| Density | 1.171g/cm3 | Boiling Point | 397.4ºC at 760mmHg | |
| Molecular Formula | C14H14O2S | Melting Point | 156-158ºC | |
| MSDS | Chinese USA | Flash Point | 233ºC | |
| Name | 1-methyl-4-(4-methylphenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760mmHg |
| Melting Point | 156-158ºC |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.32500 |
| Flash Point | 233ºC |
| Exact Mass | 246.07100 |
| PSA | 42.52000 |
| LogP | 4.21700 |
| Index of Refraction | 1.575 |
| InChIKey | WEAYCYAIVOIUMG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| Water Solubility | chloroform: soluble25mg/mL, clear, colorless to yellow |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Polystyrene Supported Al (OTf)3: a Stable, Efficient, Selective, and Reusable Catalyst for Sulfonylation of Arenes with Sulfonic Acids. Boroujeni, KP.
Bull. Korean Chem. Soc. 31(7) , 1887-1890, (2010)
|
|
|
Studies in the thermochemistry of sulphones. Part 6.-Heats of combustion, fusion, vaporization and atomization of six aromatic and two allylic sulphones. Mackle H and O'Hare PAG.
Trans. Faraday Soc. 57 , 1521-1526, (1961)
|
|
|
Kinetics and thermodynamics of sulfuric acid-mediated cleavage of substituted diaryl sulfones. Ward RS, et al.
J. Surfactants Deterg. 4(2) , 185-190, (2001)
|
| SO2(p-tolyl)2 |
| MFCD00041332 |
| 4,4'-dimethyl diphenyl sulfone |
| EINECS 209-969-6 |
| 4,4'-Ditolyl sulfone |
| 4,4'-dimethyldiphenyl sulphone |
| 1,1'-sulfonylbis(4-methylbenzene) |
| p,p'-Ditolyl sulfone |
| Bis(4-methylphenyl) sulfone |
| Sulfone,di-p-tolyl |
| 4,4-bis-benzenesulfonyl methane |
| Di-p-tolyl sulfone |
| 4,4'-sulfonylbis(methylbenzene) |
| p-Tolyl sulfone |
| p-tolyl sulfone(8ci) |