| Name |
N-(1-cyano-1,2-dimethylpropyl)-2-{[4-(4-methylphenyl)-5-(pyrrolidin-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}propanamide
|
| Molecular Formula |
C22H30N6OS
|
| Molecular Weight |
426.6
|
| Smiles |
Cc1ccc(-n2c(SC(C)C(=O)NC(C)(C#N)C(C)C)nnc2N2CCCC2)cc1
|
Cc1ccc(-n2c(SC(C)C(=O)NC(C)(C#N)C(C)C)nnc2N2CCCC2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.