methyl 4-[(4-methoxycarbonylphenyl)carbamoylamino]benzoate structure
|
Common Name | methyl 4-[(4-methoxycarbonylphenyl)carbamoylamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 56050-99-8 | Molecular Weight | 328.31900 | |
| Density | 1.336g/cm3 | Boiling Point | 407.2ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1ºC | |
| Name | methyl 4-[(4-methoxycarbonylphenyl)carbamoylamino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 407.2ºC at 760 mmHg |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.31900 |
| Flash Point | 200.1ºC |
| Exact Mass | 328.10600 |
| PSA | 93.73000 |
| LogP | 3.04980 |
| Index of Refraction | 1.641 |
| InChIKey | WNZWSCPMJZMGEJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2ccc(C(=O)OC)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~58%
methyl 4-[(4-me... CAS#:56050-99-8 |
| Literature: Landsberg, Dirk; Kalesse, Markus Synlett, 2010 , # 7 p. 1104 - 1106 |
|
~%
methyl 4-[(4-me... CAS#:56050-99-8 |
| Literature: Zincke; Helmert Justus Liebigs Annalen der Chemie, 1896 , vol. 291, p. 332 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-ureylene-di-benzoic acid dimethyl ester |
| 4,4'-Ureylen-di-benzoesaeure-dimethylester |
| N.N'-Carbonyl-bis-(4-amino-benzoesaeure-methylester) |
| N.N'-Bis-(4-carbomethoxy-phenyl)-harnstoff |
| Carbanilid-dicarbonsaeure-(4.4')-dimethylester |
| methyl 4-({[4-(methoxycarbonyl)phenyl]carbamoyl}amino)benzoate |