WAY-357997
Modify Date: 2024-04-03 17:31:21
WAY-357997 structure
|
Common Name | WAY-357997 | ||
|---|---|---|---|---|
| CAS Number | 39582-96-2 | Molecular Weight | 288.34 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 533.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O5S2 | Melting Point | 137-138 °C | |
| MSDS | N/A | Flash Point | 276.2±30.1 °C | |
Use of WAY-357997inhibitors of ERK1/2 |
| Name | WAY-357997 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.1±50.0 °C at 760 mmHg |
| Melting Point | 137-138 °C |
| Molecular Formula | C11H12O5S2 |
| Molecular Weight | 288.34 |
| Flash Point | 276.2±30.1 °C |
| Exact Mass | 288.012604 |
| LogP | 0.51 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | SAYGBRLGVYMXRN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2C=CS(=O)(=O)C2)cc1 |
| 1,1-Dioxido-2,3-dihydrothiophen-3-yl 4-methylbenzenesulfonate |
| 1,1-Dioxido-2,3-dihydro-3-thiophenyl 4-methylbenzenesulfonate |
| 3-Thiopheneol, 2,3-dihydro-, 4-methylbenzenesulfonate, 1,1-dioxide |
| MFCD00195966 |