WAY-357996 structure
|
Common Name | WAY-357996 | ||
|---|---|---|---|---|
| CAS Number | 39582-95-1 | Molecular Weight | 274.31 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 523.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.2±30.1 °C | |
Use of WAY-357996inhibitors of ERK1/2 |
| Name | WAY-357996 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 523.1±50.0 °C at 760 mmHg |
| Molecular Formula | C10H10O5S2 |
| Molecular Weight | 274.31 |
| Flash Point | 270.2±30.1 °C |
| Exact Mass | 273.996948 |
| LogP | 0.05 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | RFHUNIXPGHBTTE-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C=CC(OS(=O)(=O)c2ccccc2)C1 |
| 3-Thiopheneol, 2,3-dihydro-, benzenesulfonate, 1,1-dioxide |
| MFCD00441391 |
| 1,1-Dioxido-2,3-dihydro-3-thiophenyl benzenesulfonate |
| 1,1-Dioxido-2,3-dihydrothiophen-3-yl benzenesulfonate |