4-Fluoro-2-nitrobenzoic acid structure
|
Common Name | 4-Fluoro-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 394-01-4 | Molecular Weight | 185.109 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 343.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO4 | Melting Point | 147-148°C | |
| MSDS | Chinese USA | Flash Point | 161.7±23.7 °C | |
| Name | 4-Fluoro-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.8±27.0 °C at 760 mmHg |
| Melting Point | 147-148°C |
| Molecular Formula | C7H4FNO4 |
| Molecular Weight | 185.109 |
| Flash Point | 161.7±23.7 °C |
| Exact Mass | 185.012436 |
| PSA | 83.12000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | YLUCXHMYRQUERW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(F)cc1[N+](=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Intramolecular general acid catalysis of phosphate monoester hydrolysis. The hydrolysis of salicyl phosphate.
J. Chem. Soc., Perkin Trans. II 2 , 149-155, (1972)
|
|
|
Enhancement of insulin binding to rat white adipocytes at 15 degrees C by 5,5'-dithiobis-(2-nitrobenzoic acid). Independence of the reagent's sulfhydryl group reactivity.
J. Biol. Chem. 263(23) , 11175-82, (1988) Insulin binding to isolated rat white adipocytes at 15 degrees C, a temperature at which cellular degradation of insulin is negligible, has been found to be described by the Two-step Binding Model: R ... |
| Benzoic acid, 4-fluoro-2-nitro- |
| 4-Fluor-2-nitro-benzoesaeure |
| 4-Fluoro-2-nitrobenzoic acid |
| EINECS 206-890-9 |
| MFCD00024300 |
| 4-fluoro-2-nitrobenzoicacid |
| WNR CF FVQ |
| 2-nitro-4-fluorobenzoic acid |
| benzoic acid,4-fluoro-2-nitro |