17a-Hydroxypregnenolone structure
|
Common Name | 17a-Hydroxypregnenolone | ||
|---|---|---|---|---|
| CAS Number | 387-79-1 | Molecular Weight | 334.493 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 468.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O3 | Melting Point | 273℃ | |
| MSDS | Chinese USA | Flash Point | 251.0±23.8 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
Use of 17a-Hydroxypregnenolone17a-Hydroxypregnenolone is a pregnane steroid. 17a-Hydroxypregnenolone is a prohormone in the formation of dehydroepiandrosterone (DHEA). |
| Name | 17α-hydroxypregnenolone |
|---|---|
| Synonym | More Synonyms |
| Description | 17a-Hydroxypregnenolone is a pregnane steroid. 17a-Hydroxypregnenolone is a prohormone in the formation of dehydroepiandrosterone (DHEA). |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 468.1±40.0 °C at 760 mmHg |
| Melting Point | 273℃ |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 334.493 |
| Flash Point | 251.0±23.8 °C |
| Exact Mass | 334.250793 |
| PSA | 57.53000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | JERGUCIJOXJXHF-TVWVXWENSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| Storage condition | ?20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | F,T |
| Risk Phrases | 11-23/24/25-39/23/24/25 |
| Safety Phrases | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| WGK Germany | 3 |
| RTECS | TU5548000 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
|
Substrate-modulated cytochrome P450 17A1 and cytochrome b5 interactions revealed by NMR.
J. Biol. Chem. 288(23) , 17008-18, (2013) The membrane heme protein cytochrome b5 (b5) can enhance, inhibit, or have no effect on cytochrome P450 (P450) catalysis, depending on the specific P450, substrate, and reaction conditions, but the st... |
|
|
Serum concentrations of adrenal steroids and their precursors as a measure of maturity of adrenocortical function in very premature newborns.
Horm. Res. Paediatr. 74(5) , 358-64, (2010) Relative adrenocortical insufficiency is often seen in sick premature newborns. As the human fetal adrenal cortex does not express the 3β-hydroxysteroid dehydrogenase (3β-HSD) enzyme before about 23 w... |
|
|
Clinicopathological features, biochemical and molecular markers in 5 patients with adrenocortical carcinoma.
Endocr. J. 58(7) , 527-34, (2011) Adrenocortical carcinoma (ACC) is a very rare malignant tumor with poor prognosis. To gain insight into the pathogenic significance of ACC, we studied clinicopathological features and gene expression ... |
| MFCD00021129 |
| Pregnan-2-one, 3,17-dihydroxy- |
| Hydroxypregnenolone |
| EINECS 206-862-6 |
| HYDROXYPREGNENOLONE,17A |
| 17a-Hydroxypregnolone |
| 17alpha-Hydroxy |
| 5-Pregnen-3.β.,17.α.-diol-20-one |
| 17-OH PREG |
| 3,17-Dihydroxypregnan-2-one |
| 17-OH-pregnenolone |
| 17A-HYDROXY PREGNENOLONE |
| 17alpha-hydroxypregnenolone |
| 17-Hydroxy Pregnenolone |
| 17A-HYDROXYPREGENOLONE |