Altechromone A structure
|
Common Name | Altechromone A | ||
|---|---|---|---|---|
| CAS Number | 38412-47-4 | Molecular Weight | 190.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Altechromone AAltechromone A is a natural product that can be isolated from Polygonum cuspidatum[1]. |
| Name | 7-hydroxy-2,5-dimethylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Altechromone A is a natural product that can be isolated from Polygonum cuspidatum[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H10O3 |
|---|---|
| Molecular Weight | 190.19500 |
| Exact Mass | 190.06300 |
| PSA | 50.44000 |
| LogP | 2.11540 |
| InChIKey | CRNGFKXWIYTEPH-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(C)cc(O)cc2o1 |
| 7-hydroxy-2,5-dimethyl-chromen-4-one |
| 7-Hydroxy-2,5-dimethyl-4H-chromen-4-one |
| 7-Hydroxy-2,5-dimethylchromone |
| 2,5-Dimethyl-7-hydroxychromon |
| 7-Hydroxy-2,5-dimethyl-chromen-4-on |
| 4H-1-Benzopyran-4-one,7-hydroxy-2,5-dimethyl |
| 7-Hydroxy-2,5-dimethyl-4-chromon |
| Altechromone A |
| 2,5-dimethyl-7-hydroxychromone |