Benzoic acid,3,5-dibromo-2,4-dihydroxy-6-methyl-, ethyl ester structure
|
Common Name | Benzoic acid,3,5-dibromo-2,4-dihydroxy-6-methyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21855-46-9 | Molecular Weight | 353.99200 | |
| Density | 1.869g/cm3 | Boiling Point | 323.1ºC at 760mmHg | |
| Molecular Formula | C10H10Br2O4 | Melting Point | 138-142ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 149.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.869g/cm3 |
|---|---|
| Boiling Point | 323.1ºC at 760mmHg |
| Melting Point | 138-142ºC(lit.) |
| Molecular Formula | C10H10Br2O4 |
| Molecular Weight | 353.99200 |
| Flash Point | 149.2ºC |
| Exact Mass | 351.89500 |
| PSA | 66.76000 |
| LogP | 3.10790 |
| Vapour Pressure | 0.000142mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | RVOPKMSNJRHIAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c(Br)c(O)c(Br)c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
|
~87%
Benzoic acid,3,... CAS#:21855-46-9 |
| Literature: Gramatica, Paola; Gianotti, M. Pia; Speranza, Giovanna; Manitto, Paolo Heterocycles, 1986 , vol. 24, # 3 p. 743 - 750 |
|
~%
Benzoic acid,3,... CAS#:21855-46-9 |
| Literature: Tetrahedron Letters, , vol. 35, # 44 p. 8171 - 8172 |
|
~%
Benzoic acid,3,... CAS#:21855-46-9 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 117, p. 312 |
|
~%
Benzoic acid,3,... CAS#:21855-46-9 |
| Literature: Chemische Berichte, , vol. 61, p. 926 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 3,5-dibromo-2,4-dihydroxy-6-methyl benzoate |
| ethyl 3,5-dibromo-orsellinate |
| Ethyl 2,4-dihydroxy-3,5-dibromo-6-methylbenzoate |
| 3,5-Dibrom-2,4-dihydroxy-6-methyl-benzoesaeure-aethylester |
| eso-Dibrom-orsellinsaeure-aethylester |
| MFCD00134116 |
| 3,5-dibromo-2,4-dihydroxy-6-methyl-benzoic acid ethyl ester |
| 3.5-Dibrom-orsellinsaeure-aethylester |