WAY-606758 structure
|
Common Name | WAY-606758 | ||
|---|---|---|---|---|
| CAS Number | 380463-01-4 | Molecular Weight | 225.28 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.9±14.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.0±20.1 °C | |
Use of WAY-606758Ccr5 antagonist |
| Name | WAY-606758 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.9±14.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.28 |
| Flash Point | 238.0±20.1 °C |
| Exact Mass | 225.136490 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | JAZMWVSZLPKNMA-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1(CC(=O)NC2CC2)CCCC1 |
| {1-[2-(Cyclopropylamino)-2-oxoethyl]cyclopentyl}acetic acid |
| Cyclopentaneacetic acid, 1-[2-(cyclopropylamino)-2-oxoethyl]- |
| MFCD03154062 |