ACDPP Hydrochloride structure
|
Common Name | ACDPP Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 37804-11-8 | Molecular Weight | 292.72 | |
| Density | N/A | Boiling Point | 473.6ºC at 760 mmHg | |
| Molecular Formula | C12H13ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.3ºC | |
Use of ACDPP HydrochlorideACDPP is a specific mGluR5 antagonist. ACDPP partially bolcks the increase of fragile X mental retardation protein (FMRP) caused by DHPG (HY-12598A) (group I mGluR Agonist)[1]. |
| Name | 3-amino-6-chloro-5-(dimethylamino)-N-pyridin-3-ylpyrazine-2-carboxamide,hydrochloride |
|---|
| Description | ACDPP is a specific mGluR5 antagonist. ACDPP partially bolcks the increase of fragile X mental retardation protein (FMRP) caused by DHPG (HY-12598A) (group I mGluR Agonist)[1]. |
|---|---|
| Related Catalog | |
| Target |
mGluR5[1] |
| References |
| Boiling Point | 473.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H13ClN6O |
| Molecular Weight | 292.72 |
| Flash Point | 240.3ºC |
| Exact Mass | 328.06100 |
| PSA | 97.03000 |
| LogP | 2.88170 |
| InChIKey | CXIHLPLRTFPHKX-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(N)c(C(=O)Nc2cccnc2)nc1Cl.Cl |
|
~%
ACDPP Hydrochloride CAS#:37804-11-8 |
| Literature: Bonnefous, Celine; Vernier, Jean-Michel; Hutchinson, John H.; Chung, Janice; Reyes-Manalo, Grace; Kamenecka, Theodore Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 4 p. 1197 - 1200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |