WAY-311811 structure
|
Common Name | WAY-311811 | ||
|---|---|---|---|---|
| CAS Number | 376374-54-8 | Molecular Weight | 476.55 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 732.5±70.0 °C at 760 mmHg | |
| Molecular Formula | C25H24N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.8±35.7 °C | |
Use of WAY-311811integrin inhibitor for treating and preventing inflammatory diseases; inhibitors of solute transporters; inhibitors of urea transporter UT-B . |
| Name | WAY-311811 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 732.5±70.0 °C at 760 mmHg |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.55 |
| Flash Point | 396.8±35.7 °C |
| Exact Mass | 476.151825 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | FBFISYMGQUXGNW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nnc(Nc3ccc(O)cc3)c3ccccc23)cc1S(=O)(=O)N1CCOCC1 |
| Phenol, 4-[[4-[4-methyl-3-(4-morpholinylsulfonyl)phenyl]-1-phthalazinyl]amino]- |
| 4-{4-[4-Methyl-3-(morpholine-4-sulfonyl)-phenyl]-phthalazin-1-ylamino}-phenol |
| 4-({4-[4-Methyl-3-(morpholin-4-ylsulfonyl)phenyl]phthalazin-1-yl}amino)phenol |
| 4-({4-[4-Methyl-3-(4-morpholinylsulfonyl)phenyl]-1-phthalazinyl}amino)phenol |