WAY-298668 structure
|
Common Name | WAY-298668 | ||
|---|---|---|---|---|
| CAS Number | 371224-09-8 | Molecular Weight | 405.44972 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H23N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-298668altering the lifespan of a eukaryotic organism; Aurora-A inhibitors; JAMM protease inhibitors; |
| Name | WAY-298668 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.44972 |
| Exact Mass | 405.180084 |
| LogP | 1.96 |
| Index of Refraction | 1.660 |
| InChIKey | KQAQQNMXXWWOOB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2nc(NC3=NC(c4ccc(OC)cc4)CC(=O)N3)nc(C)c2c1 |
| 2-[(6-ethoxy-4-methylquinazolin-2-yl)amino]-6-(4-methoxyphenyl)-5,6-dihydropyrimidin-4(3H)-one |
| 2-[(6-Ethoxy-4-methyl-2-quinazolinyl)amino]-6-(4-methoxyphenyl)-5,6-dihydro-4(3H)-pyrimidinone |
| 4(3H)-Pyrimidinone, 2-[(6-ethoxy-4-methyl-2-quinazolinyl)amino]-5,6-dihydro-6-(4-methoxyphenyl)- |