WAY-297629 structure
|
Common Name | WAY-297629 | ||
|---|---|---|---|---|
| CAS Number | 371213-22-8 | Molecular Weight | 346.38 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 575.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6±30.1 °C | |
Use of WAY-297629VEGFR2 inhibitor |
| Name | WAY-297629 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.1±50.0 °C at 760 mmHg |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.38 |
| Flash Point | 301.6±30.1 °C |
| Exact Mass | 346.131744 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | ICXLGEZBHYTHDQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(-c3ccc4ccccc4c3O)[nH]n2)cc1OC |
| 1-Naphthalenol, 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-3-yl]- |
| 2-[5-(3,4-Dimethoxy-phenyl)-1H-pyrazol-3-yl]-naphthalen-1-ol |
| 2-[5-(3,4-Dimethoxyphenyl)-1H-pyrazol-3-yl]-1-naphthol |