Hydroxy-PEG6-Boc structure
|
Common Name | Hydroxy-PEG6-Boc | ||
|---|---|---|---|---|
| CAS Number | 361189-64-2 | Molecular Weight | 410.50000 | |
| Density | 1.068 g/ml | Boiling Point | N/A | |
| Molecular Formula | C19H38O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hydroxy-PEG6-BocHydroxy-PEG7-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-butyl 1-hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oate |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG7-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.068 g/ml |
|---|---|
| Molecular Formula | C19H38O9 |
| Molecular Weight | 410.50000 |
| Exact Mass | 410.25200 |
| PSA | 101.91000 |
| LogP | 0.81010 |
| InChIKey | VGGDPFAYSOSIOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCO |
| hydroxy-peg6-tertbutyl ester |
| Hydroxy-PEG6-t-butly ester |