Anticonvulsant agent 1 structure
|
Common Name | Anticonvulsant agent 1 | ||
|---|---|---|---|---|
| CAS Number | 357336-17-5 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Anticonvulsant agent 1Anticonvulsant agent 1 is an anticonvulsant agent extracted from patent WO2001062726A2, Compound 156. |
| Name | Anticonvulsant agent 1 |
|---|
| Description | Anticonvulsant agent 1 is an anticonvulsant agent extracted from patent WO2001062726A2, Compound 156. |
|---|---|
| Related Catalog | |
| In Vitro | The inhibition constant (Ki) of Anticonvulsant agent 1 (Compound 156) is determined in competitive binding experiments by measuring the binding of a single concentration of a radioactive ligand at equilibrium with various concentrations of the unlabeled test substance. The concentration of the test substance inhibiting 50 % of the specific binding of the radioligand is called the IC50. The equilibrium dissociation constant Ki is proportional to the IC50 and is calculated. Anticonvulsant agent 1 shows pKi values of 6.0 and greater[1] |
| References |
| Molecular Weight | 232.23 |
|---|---|
| InChIKey | ANWPENAPCIFDSZ-UHFFFAOYSA-N |
| SMILES | CCC(C(N)=O)N1CC(C=C(F)F)CC1=O |