Antileishmanial agent-1 structure
|
Common Name | Antileishmanial agent-1 | ||
|---|---|---|---|---|
| CAS Number | 2454115-43-4 | Molecular Weight | 409.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11Br2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Antileishmanial agent-1Antileishmanial agent-1 exhibits the activity against L. amazonensis promastigotes (IC50 = 15.52 μM) and intracellular amastigotes (IC50 = 4.10 μM). |
| Name | Antileishmanial agent-1 |
|---|
| Description | Antileishmanial agent-1 exhibits the activity against L. amazonensis promastigotes (IC50 = 15.52 μM) and intracellular amastigotes (IC50 = 4.10 μM). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H11Br2N3O |
|---|---|
| Molecular Weight | 409.08 |
| InChIKey | ADBZXYOFJKVXLD-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(Br)cc1)c1cn(-c2ccc(Br)cc2)nn1 |