RIPGBM
Modify Date: 2025-09-20 07:01:23
RIPGBM structure
|
Common Name | RIPGBM | ||
|---|---|---|---|---|
| CAS Number | 355406-76-7 | Molecular Weight | 428.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RIPGBMRIPGBM is a selective inducer of apoptosis in glioblastoma multiforme (GBM) cancer stem cells (CSCs) with an EC50 of ≤500 nM[1]. |
| Name | RIPGBM |
|---|
| Description | RIPGBM is a selective inducer of apoptosis in glioblastoma multiforme (GBM) cancer stem cells (CSCs) with an EC50 of ≤500 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: ≤500 nM (Apoptosis, in GBM CSCs)[1] |
| In Vitro | RIPGBM induces caspase 1-dependent apoptosis by binding to receptor-interacting protein kinase 2 (RIPK2) and acting as a molecular switch, which reduces the formation of a prosurvival RIPK2/ TAK1 complex and increases the formation of a proapoptotic RIPK2/caspase 1 complex[1]. |
| References |
| Molecular Formula | C26H21FN2O3 |
|---|---|
| Molecular Weight | 428.45 |
| InChIKey | COATXBHZYVUJQP-UHFFFAOYSA-N |
| SMILES | CC(=O)N(Cc1ccc(F)cc1)C1=C(NCc2ccccc2)C(=O)c2ccccc2C1=O |
| Hazard Codes | Xi |
|---|