5,5,6,6,7,7,8,8,8-NONAFLUORO-2,4-OCTANEDIONE structure
|
Common Name | 5,5,6,6,7,7,8,8,8-NONAFLUORO-2,4-OCTANEDIONE | ||
|---|---|---|---|---|
| CAS Number | 355-84-0 | Molecular Weight | 304.11000 | |
| Density | 1.49g/cm3 | Boiling Point | 165.1ºC at 760mmHg | |
| Molecular Formula | C8H5F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 59.1ºC | |
| Name | 1,1,1,2,2,3,3,4,4-Nonafluoro-5,7-octanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 165.1ºC at 760mmHg |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11000 |
| Flash Point | 59.1ºC |
| Exact Mass | 304.01500 |
| PSA | 34.14000 |
| LogP | 3.00280 |
| InChIKey | NQPVZXRGQCXFLN-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2914700090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5,5,6,6,7,7,8,8,8-nonafluorooctane-2,4-dione |