3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dimethyloctanal structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dimethyloctanal | ||
|---|---|---|---|---|
| CAS Number | 56734-80-6 | Molecular Weight | 390.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7F13O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dimethyloctanal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7F13O |
|---|---|
| Molecular Weight | 390.14100 |
| Exact Mass | 390.02900 |
| PSA | 17.07000 |
| LogP | 4.95030 |
| InChIKey | OEEWMVVCOXAOSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
3,3,4,4,5,5,6,6... CAS#:56734-80-6 |
| Literature: Cantacuzene,D.; Dorme,R. Tetrahedron Letters, 1975 , p. 2031 - 2034 |
|
~%
3,3,4,4,5,5,6,6... CAS#:56734-80-6 |
| Literature: Cantacuzene,D. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1365 - 1371 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Octanal,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dimethyl |
| 2H,2H-tridecafluoro-2,2-dimethyl-octanal |