p-(2-acetamidoethyl)benzenesulphonyl chloride structure
|
Common Name | p-(2-acetamidoethyl)benzenesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 35450-53-4 | Molecular Weight | 261.72500 | |
| Density | 1.322g/cm3 | Boiling Point | 465.8ºC at 760mmHg | |
| Molecular Formula | C10H12ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | 4-(2-acetamidoethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 465.8ºC at 760mmHg |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.72500 |
| Flash Point | 235.5ºC |
| Exact Mass | 261.02300 |
| PSA | 71.62000 |
| LogP | 2.76440 |
| Index of Refraction | 1.546 |
| InChIKey | VSHNWNOZERVVNK-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~76%
p-(2-acetamidoe... CAS#:35450-53-4 |
| Literature: Ha-Duong; Dijols; Marques-Soares; Minoletti; Dansette; Mansuy Journal of Medicinal Chemistry, 2001 , vol. 44, # 22 p. 3622 - 3631 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 252-574-9 |