N-[2-(4-Sulfamoylphenyl)ethyl]acetamide structure
|
Common Name | N-[2-(4-Sulfamoylphenyl)ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 41472-49-5 | Molecular Weight | 242.295 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O3S | Melting Point | 168-174°C | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Melting Point | 168-174°C |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.295 |
| Flash Point | 188.1ºC |
| Exact Mass | 242.072510 |
| PSA | 97.64000 |
| LogP | -0.68 |
| Index of Refraction | 1.560 |
| InChIKey | IIMGUEXQORZTID-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2935009090 |
|
~78%
N-[2-(4-Sulfamo... CAS#:41472-49-5 |
| Literature: Srivastava; Jude, Kevin M.; Banerjee, Abir L.; Haldar, Manas; Manokaran, Sumathra; Kooren, Joel; Mallik, Sanku; Christianson, David W. Journal of the American Chemical Society, 2007 , vol. 129, # 17 p. 5528 - 5537 |
|
~91%
N-[2-(4-Sulfamo... CAS#:41472-49-5 |
| Literature: Zhang, Hui-bin; Zhang, Ya-an; Wu, Guan-zhong; Zhou, Jin-pei; Huang, Wen-long; Hu, Xiao-wen Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 6 p. 1740 - 1744 |
|
~%
N-[2-(4-Sulfamo... CAS#:41472-49-5 |
| Literature: Miller et al. Journal of the American Chemical Society, 1940 , vol. 62, p. 2099,2101 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-(2-acetylamino-ethyl)-benzenesulfonic acid amide |
| 4-(2-Acetylamino-aethyl)-benzolsulfonsaeure-amid |
| Acetamide, N-[[4-(2-aminoethyl)phenyl]sulfonyl]- |
| 1-(2-Acetamino-aethyl)-benzolsulfonamid-(4) |
| N-Acetyl-4-(2-aminoethyl)-benzenesulfonamide |
| N-{[4-(2-Aminoethyl)phenyl]sulfonyl}acetamide |
| N-[2-(4-Sulfamoylphenyl)ethyl]acetamide |
| M25 |
| 4-(N-acetyl-2-aminoethyl)benzenesulfonamide |
| N-(P-SULFAMOYLPHENETHYL)ACETAMIDE |
| Acetamide, N-[2-[4-(aminosulfonyl)phenyl]ethyl]- |
| N-[2-[4-(Aminosulfonyl)phenyl]ethyl]-acetamide |
| EINECS 255-386-5 |
| 2nns |
| N-(4-Sulfamoylphenethyl)acetamide |
| N-(4-Sulfamoyl-phenaethyl)-acetamid |
| 2nmx |
| MFCD00193755 |