p-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)benzenesulphonyl chloride
Modify Date: 2025-09-18 08:30:49
p-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)benzenesulphonyl chloride structure
|
Common Name | p-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)benzenesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 36898-42-7 | Molecular Weight | 271.67700 | |
| Density | 1.627g/cm3 | Boiling Point | 438.5ºC at 760mmHg | |
| Molecular Formula | C10H6ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 4-(2,5-dioxopyrrol-1-yl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760mmHg |
| Molecular Formula | C10H6ClNO4S |
| Molecular Weight | 271.67700 |
| Flash Point | 219ºC |
| Exact Mass | 270.97100 |
| PSA | 79.90000 |
| LogP | 2.18930 |
| Index of Refraction | 1.65 |
| InChIKey | COLZNHMZLVPQFK-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(S(=O)(=O)Cl)cc1 |
| HS Code | 2925190090 |
|---|
|
~83%
p-(2,5-dihydro-... CAS#:36898-42-7 |
| Literature: Cremlyn, Richard; Nunes, Richardo Phosphorus and Sulfur and the Related Elements, 1987 , vol. 31, p. 245 - 254 |
|
~%
p-(2,5-dihydro-... CAS#:36898-42-7 |
| Literature: Correa; Cechinel Filho; Rosa; Isolani Pereira; Schlemper; Nunes Pharmaceutical Sciences, 1997 , vol. 3, # 2 p. 67 - 71 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-[4-(chlorosulfonyl)phenyl]maleimide |
| N-(p-chlorosulphonyl)phenylmaleimide |
| EINECS 253-265-1 |
| N-(p-chlorosulfonylphenyl)maleimide |
| N-p-chloro-sulfonylfenylmaleimide |
| N-(p-chlorosulphonyl)phenylmalemide |
| 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzenesulfonyl chloride |
| 4-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)benzenesulfonyl chloride |
| 4-(N-maleimidyl)benzenesulfonyl chloride |