p-(pentadecafluoroheptyl)benzenesulphonyl chloride
Modify Date: 2025-11-26 05:57:05
p-(pentadecafluoroheptyl)benzenesulphonyl chloride structure
|
Common Name | p-(pentadecafluoroheptyl)benzenesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 25444-35-3 | Molecular Weight | 544.66400 | |
| Density | 1.679g/cm3 | Boiling Point | 309.2ºC at 760 mmHg | |
| Molecular Formula | C13H4ClF15O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.679g/cm3 |
|---|---|
| Boiling Point | 309.2ºC at 760 mmHg |
| Molecular Formula | C13H4ClF15O2S |
| Molecular Weight | 544.66400 |
| Flash Point | 140.8ºC |
| Exact Mass | 543.93800 |
| PSA | 42.52000 |
| LogP | 7.52550 |
| Vapour Pressure | 0.00118mmHg at 25°C |
| Index of Refraction | 1.377 |
| InChIKey | PPKJGFABEANLHW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Perfluorheptyl-benzolsulfonsaeurechlorid |
| p-(pentadecafluoroheptyl)benzenesulfonyl chloride |
| 4-(pentadecafluoroheptyl)benzenesulfonyl chloride |
| p-(Pentadecafluoroheptyl)benzenesulphonyl chloride |
| EINECS 246-984-7 |