Bicyclopyrone structure
|
Common Name | Bicyclopyrone | ||
|---|---|---|---|---|
| CAS Number | 352010-68-5 | Molecular Weight | 399.36 | |
| Density | 1.387g/cm3 | Boiling Point | 489.521ºC at 760 mmHg | |
| Molecular Formula | C19H20F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.853ºC | |
Use of BicyclopyroneBicyclopyrone is an inhibitor of 4-hydroxyphenylpyruvate dioxygenase (Hpd)[1]. |
| Name | bicyclopyrone |
|---|---|
| Synonym | More Synonyms |
| Description | Bicyclopyrone is an inhibitor of 4-hydroxyphenylpyruvate dioxygenase (Hpd)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 4-hydroxyphenylpyruvate dioxygenase catalyzes the conversion of 4-hydroxyphenylpyruvate to homogentisate is the last step in the melanin biosynthesis pathway[1]. |
| References |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 489.521ºC at 760 mmHg |
| Molecular Formula | C19H20F3NO5 |
| Molecular Weight | 399.36 |
| Flash Point | 249.853ºC |
| Exact Mass | 399.12900 |
| PSA | 85.72000 |
| LogP | 3.25720 |
| Index of Refraction | 1.547 |
| InChIKey | AIAYSXFWIUNXRC-PHIMTYICSA-N |
| SMILES | COCCOCc1nc(C(F)(F)F)ccc1C(O)=C1C(=O)C2CCC(C2)C1=O |
| Hazard Codes | Xi |
|---|
|
~%
Bicyclopyrone CAS#:352010-68-5 |
| Literature: SYNGENTA PARTICIPATIONS AG; SYNGENTA LIMITED Patent: WO2005/105745 A1, 2005 ; Location in patent: Page/Page column 24 ; |
| 4-Hydroxy-3-[2-(2-methoxyethoxymethyl)-6-trifluoromethylpyridine-3-carbonyl]-bicyclo[3.2.1]oct-3-en-2-one |
| 4-hydroxy-3-{[2-(2-methoxy-ethoxy)methyl-6-(trifluoromethyl)-3-pyridinyl]carbonyl}bicyclo[3.2.1]oct-3-en-2-one |
| rac-(1R,5R)-4-hydroxy-3-{2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)pyridine-3-carbonyl}bicyclo[3.2.1]oct-3-en-2-one |
| 4-hydroxy-3-{2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridylcarbonyl}bicyclo[3.2.1]oct-3-en-2-one |
| 4-Hydroxy-3-[1]naphthylmethyl-benzoesaeure |
| 4-hydroxy-3-[1]naphthylmethyl-benzoic acid |
| 4-hydroxy-3-[[2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridinyl]carbonyl]bicyclo[3.2.1]oct-3-en-2-one |
| 4-hydroxy-3-(2-methoxyethoxymethyl-6-trifluoromethyl-pyridin-3-yl-carbonyl)-bicyclo[3.2.1]oct-3-en-2-one |
| 4-Hydroxy-3-({2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-p yridinyl}carbonyl)bicyclo[3.2.1]oct-3-en-2-one |
| Benzoic acid,4-hydroxy-3-(1-naphthalenylmethyl) |