WAY-345285 structure
|
Common Name | WAY-345285 | ||
|---|---|---|---|---|
| CAS Number | 342382-84-7 | Molecular Weight | 271.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 406.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C15H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8±25.7 °C | |
Use of WAY-345285stratum corneum chymotryptic enzyme (SCCE) inhibitors |
| Name | WAY-345285 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.7±34.0 °C at 760 mmHg |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.33 |
| Flash Point | 199.8±25.7 °C |
| Exact Mass | 271.066711 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | YQWJALSURRKLTN-UHFFFAOYSA-N |
| SMILES | CCc1cc2c(=O)oc(-c3ccccc3C)nc2s1 |
| 6-Ethyl-2-o-tolyl-thieno[2,3-d][1,3]oxazin-4-one |
| 4H-Thieno[2,3-d][1,3]oxazin-4-one, 6-ethyl-2-(2-methylphenyl)- |
| 6-Ethyl-2-(2-methylphenyl)-4H-thieno[2,3-d][1,3]oxazin-4-one |