WAY-310301
Modify Date: 2025-08-26 20:33:50
WAY-310301 structure
|
Common Name | WAY-310301 | ||
|---|---|---|---|---|
| CAS Number | 332921-97-8 | Molecular Weight | 326.37 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 512.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.6±32.9 °C | |
Use of WAY-310301anti-inflammatory, COX inhibitory activities and ulcerogenic liability |
| Name | WAY-310301 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 512.3±60.0 °C at 760 mmHg |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.37 |
| Flash Point | 263.6±32.9 °C |
| Exact Mass | 326.072510 |
| LogP | 4.64 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | OZHHJZMKOWPQKG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nnc(SCC(=O)c3ccccc3)o2)cc1 |
| 2-{[5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-1-phenylethanone |
| 2-[5-(4-Methoxy-phenyl)-[1,3,4]oxadiazol-2-ylsulfanyl]-1-phenyl-ethanone |
| Ethanone, 2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thio]-1-phenyl- |