6-FITC structure
|
Common Name | 6-FITC | ||
|---|---|---|---|---|
| CAS Number | 3326-31-6 | Molecular Weight | 389.381 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 719.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.7±32.9 °C | |
Use of 6-FITC6-Fluorescein isothiocyanate(6-FITC) is a derivative of fluorescein used in wide-ranging applications including flow cytometry. |
| Name | 6-Fluorescein Isothiocyanate |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Fluorescein isothiocyanate(6-FITC) is a derivative of fluorescein used in wide-ranging applications including flow cytometry. |
|---|---|
| Related Catalog |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 719.1±60.0 °C at 760 mmHg |
| Molecular Formula | C21H11NO5S |
| Molecular Weight | 389.381 |
| Flash Point | 388.7±32.9 °C |
| Exact Mass | 389.035797 |
| PSA | 120.44000 |
| LogP | 4.00 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.754 |
| InChIKey | NUKUMXUIWPGENW-UHFFFAOYSA-N |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2cccc(N=C=S)c21 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Fluorescein isothiocyanate |
| Fluorescein-6-isothiocyanate |
| 6-Fluorescein isothiocyanate |
| FITC |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-6-isothiocyanato- |
| 4-aminofluorescein |
| fluoresceinamine |
| 3',6'-Dihydroxy-6-isothiocyanato-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| fluoresceinisothiocyanate |
| fluorescein 6-isothiocyanate |
| 6-FITC |