WAY-311788
Modify Date: 2025-11-26 00:46:01
WAY-311788 structure
|
Common Name | WAY-311788 | ||
|---|---|---|---|---|
| CAS Number | 332105-99-4 | Molecular Weight | 377.35 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 689.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H15N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.0±31.5 °C | |
Use of WAY-311788Antiproliferative properties |
| Name | WAY-311788 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 689.8±55.0 °C at 760 mmHg |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.35 |
| Flash Point | 371.0±31.5 °C |
| Exact Mass | 377.101166 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | TZRLLDCWRLRDRT-QGOAFFKASA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(=Cc1ccco1)NC(=O)c1ccccc1 |
| Benzamide, N-[(E)-2-(2-furanyl)-1-[[(4-nitrophenyl)amino]carbonyl]ethenyl]- |
| N-{(1E)-1-(2-Furyl)-3-[(4-nitrophenyl)amino]-3-oxo-1-propen-2-yl}benzamide |
| N-[2-Furan-2-yl-1-(4-nitro-phenylcarbamoyl)-vinyl]-benzamide |
| N-{(1E)-1-(2-Furyl)-3-[(4-nitrophenyl)amino]-3-oxoprop-1-en-2-yl}benzamide |